Products 2471978-97-7
CAS 2471978-97-7 appears in our catalog under these names: BAY–298, BAY-298, 99.96%, BAY-298, 99.94%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 25 mg, 10mM/1mL, 50 mg, 5 mg, 100 mg, 10 mg.
(5S)-5-(4-chlorophenyl)-N-[4-(4-fluorophenoxy)phenyl]-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide (CAS 2471978-97-7) is a chemical compound with the molecular formula C27H21ClFN3O2 and a molecular weight of 473.9 g/mol. IUPAC name: (5S)-5-(4-chlorophenyl)-N-[4-(4-fluorophenoxy)phenyl]-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide. InChIKey: FMQWOAKTQPLQBR-SANMLTNESA-N.
| Molecular formula | C27H21ClFN3O2 |
|---|---|
| Molecular weight | 473.9 g/mol |
| IUPAC name | (5S)-5-(4-chlorophenyl)-N-[4-(4-fluorophenoxy)phenyl]-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide |
| InChIKey | FMQWOAKTQPLQBR-SANMLTNESA-N |
| SMILES | C1CN([C@H](C2=C1N=CC=C2)C3=CC=C(C=C3)Cl)C(=O)NC4=CC=C(C=C4)OC5=CC=C(C=C5)F |
Computed by PubChem (NCBI)
Synonyms:
orb1710320, orb1818712