CAS 2472467-23-3 is the registry number for 2-(2,5-Dihydrofuran-3-yl)-4,4,5-trimethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-dihydrofuran-3-yl)-4,4,5-trimethyl-1,3,2-dioxaborolane (CAS 2472467-23-3) is a chemical compound with the molecular formula C9H15BO3 and a molecular weight of 182.03 g/mol. IUPAC name: 2-(2,5-dihydrofuran-3-yl)-4,4,5-trimethyl-1,3,2-dioxaborolane. InChIKey: HXTZLAIMYQTQNV-UHFFFAOYSA-N.
| Molecular formula | C9H15BO3 |
|---|---|
| Molecular weight | 182.03 g/mol |
| IUPAC name | 2-(2,5-dihydrofuran-3-yl)-4,4,5-trimethyl-1,3,2-dioxaborolane |
| InChIKey | HXTZLAIMYQTQNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)C)C2=CCOC2 |
Computed by PubChem (NCBI)