CAS 2472968-83-3 is the registry number for 2-Amino-3-hydroxy-N',N'-bis(2,3,4-trihydroxybenzyl)propanehydrazide, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-hydroxy-N',N'-bis[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide (CAS 2472968-83-3) is a chemical compound with the molecular formula C17H21N3O8 and a molecular weight of 395.4 g/mol. IUPAC name: 2-amino-3-hydroxy-N',N'-bis[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide. InChIKey: GQUNNCFLFSEWTM-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O8 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 2-amino-3-hydroxy-N',N'-bis[(2,3,4-trihydroxyphenyl)methyl]propanehydrazide |
| InChIKey | GQUNNCFLFSEWTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CN(CC2=C(C(=C(C=C2)O)O)O)NC(=O)C(CO)N)O)O)O |
Computed by PubChem (NCBI)