CAS 2474671-24-2 is the registry number for 3-(5-Bromo-4-chloro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-bromo-7-chloro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2474671-24-2) is a chemical compound with the molecular formula C13H10BrClN2O3 and a molecular weight of 357.58 g/mol. IUPAC name: 3-(6-bromo-7-chloro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: AXUDAZIRQAYYLF-UHFFFAOYSA-N.
| Molecular formula | C13H10BrClN2O3 |
|---|---|
| Molecular weight | 357.58 g/mol |
| IUPAC name | 3-(6-bromo-7-chloro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | AXUDAZIRQAYYLF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3Cl)Br |
Computed by PubChem (NCBI)