CAS 247568-67-8 appears in our catalog under these names: Xanthoanthrafil Impurity 1, N-(3,4-Dimethoxybenzyl)-2-fluoro-5-nitrobenzamide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
N-[(3,4-dimethoxyphenyl)methyl]-2-fluoro-5-nitrobenzamide (CAS 247568-67-8) is a chemical compound with the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-2-fluoro-5-nitrobenzamide. InChIKey: CJAKIEOOMLAGMN-UHFFFAOYSA-N.
| Molecular formula | C16H15FN2O5 |
|---|---|
| Molecular weight | 334.30 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-2-fluoro-5-nitrobenzamide |
| InChIKey | CJAKIEOOMLAGMN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])F)OC |
Computed by PubChem (NCBI)