CAS 247592-78-5 is the registry number for N-(4-Bromophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide. Offered by: Biosynth. Available pack sizes: 2,5g.
N-(4-bromophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide (CAS 247592-78-5) is a chemical compound with the molecular formula C16H14BrNO4 and a molecular weight of 364.19 g/mol. IUPAC name: N-(4-bromophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide. InChIKey: RLVKMMUCVSOHGC-UHFFFAOYSA-N.
| Molecular formula | C16H14BrNO4 |
|---|---|
| Molecular weight | 364.19 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-(4-formyl-2-methoxyphenoxy)acetamide |
| InChIKey | RLVKMMUCVSOHGC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)