CAS 24762-44-5 appears in our catalog under these names: Triphenylphosphine-d15, >95% (HPLC), Triphenylphosphine-d15, 99 atom % D, min 98% Chemical Purity, TRIPHENYLPHOSPHINE-D15, >=98 ATOM % D, &. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 10mg, 50mg, 0,25g, 1G.
Tris(2,3,4,5,6-pentadeuteriophenyl)phosphane (CAS 24762-44-5) is a chemical compound with the molecular formula C18H15P and a molecular weight of 277.4 g/mol. IUPAC name: tris(2,3,4,5,6-pentadeuteriophenyl)phosphane. InChIKey: RIOQSEWOXXDEQQ-KLHTYYPYSA-N.
| Molecular formula | C18H15P |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | tris(2,3,4,5,6-pentadeuteriophenyl)phosphane |
| InChIKey | RIOQSEWOXXDEQQ-KLHTYYPYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])P(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)