Products 2477520-26-4
CAS 2477520-26-4 appears in our catalog under these names: 2–Ethylfuran–d5, 2-Ethylfuran-d5, D5-2-Ethylfuran, D5-2-Ethylfuran, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 1mg, 1 mg, 1x10mg, 1x1ml.
2-(1,1,2,2,2-pentadeuterioethyl)furan (CAS 2477520-26-4) is a chemical compound with the molecular formula C6H8O and a molecular weight of 101.16 g/mol. IUPAC name: 2-(1,1,2,2,2-pentadeuterioethyl)furan. InChIKey: HLPIHRDZBHXTFJ-ZBJDZAJPSA-N.
| Molecular formula | C6H8O |
|---|---|
| Molecular weight | 101.16 g/mol |
| IUPAC name | 2-(1,1,2,2,2-pentadeuterioethyl)furan |
| InChIKey | HLPIHRDZBHXTFJ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC=CO1 |
Computed by PubChem (NCBI)