Products 2477520-27-5
CAS 2477520-27-5 appears in our catalog under these names: D11-2-Pentylfuran, D11-2-Pentylfuran, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: HPC Standards. Available pack sizes: 10mg, 1ml.
2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan (CAS 2477520-27-5) is a chemical compound with the molecular formula C9H14O and a molecular weight of 149.27 g/mol. IUPAC name: 2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan. InChIKey: YVBAUDVGOFCUSG-WRAAEXSDSA-N.
| Molecular formula | C9H14O |
|---|---|
| Molecular weight | 149.27 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)furan |
| InChIKey | YVBAUDVGOFCUSG-WRAAEXSDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=CO1 |
Computed by PubChem (NCBI)
Synonyms:
2-Pentylfuran-d11, 2-Pentyl-D11-furan