Products 2477725-07-6
CAS 2477725-07-6 is the registry number for B-Raf IN 7. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 5-amino-1-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]triazole-4-carboxylate (CAS 2477725-07-6) is a chemical compound with the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. IUPAC name: ethyl 5-amino-1-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]triazole-4-carboxylate. InChIKey: RLEPXWMHUBHGBD-UHFFFAOYSA-N.
| Molecular formula | C15H16N6O3 |
|---|---|
| Molecular weight | 328.33 g/mol |
| IUPAC name | ethyl 5-amino-1-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]triazole-4-carboxylate |
| InChIKey | RLEPXWMHUBHGBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=N1)C2=CC=C(C=C2)C3=NNC(=O)CC3)N |
Computed by PubChem (NCBI)
Synonyms:
B-Raf IN 7, orb1689101