Products 2477725-18-9
CAS 2477725-18-9 is the registry number for B-Raf IN 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-(6-oxo-1-phenyl-4,5-dihydropyridazin-3-yl)phenyl]-3-phenylthiourea (CAS 2477725-18-9) is a chemical compound with the molecular formula C23H20N4OS and a molecular weight of 400.5 g/mol. IUPAC name: 1-[4-(6-oxo-1-phenyl-4,5-dihydropyridazin-3-yl)phenyl]-3-phenylthiourea. InChIKey: NNDKPTKCHFIEKG-UHFFFAOYSA-N.
| Molecular formula | C23H20N4OS |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 1-[4-(6-oxo-1-phenyl-4,5-dihydropyridazin-3-yl)phenyl]-3-phenylthiourea |
| InChIKey | NNDKPTKCHFIEKG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(N=C1C2=CC=C(C=C2)NC(=S)NC3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
B-Raf IN 9, orb1688103