CAS 2477878-52-5 is the registry number for ASPH-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-(5-amino-4-benzylsulfonyloxy-3-oxofuran-2-yl)benzoate (CAS 2477878-52-5) is a chemical compound with the molecular formula C19H17NO7S and a molecular weight of 403.4 g/mol. IUPAC name: methyl 4-(5-amino-4-benzylsulfonyloxy-3-oxofuran-2-yl)benzoate. InChIKey: LHPXMEBVGVXZCU-UHFFFAOYSA-N.
| Molecular formula | C19H17NO7S |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | methyl 4-(5-amino-4-benzylsulfonyloxy-3-oxofuran-2-yl)benzoate |
| InChIKey | LHPXMEBVGVXZCU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2C(=O)C(=C(O2)N)OS(=O)(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)