CAS 247923-40-6 is the registry number for N-((1S,2S)-2-Amino-1,2-diphenylethyl)-2,4,6-trimethylbenzenesulfonamide. Offered by: Chemat. Available pack sizes: 50mg, 250mg, 1g.
N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide (CAS 247923-40-6) is a chemical compound with the molecular formula C23H26N2O2S and a molecular weight of 394.5 g/mol. IUPAC name: N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide. InChIKey: NHQZWDCNEJJOGT-VXKWHMMOSA-N.
| Molecular formula | C23H26N2O2S |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | NHQZWDCNEJJOGT-VXKWHMMOSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N[C@@H](C2=CC=CC=C2)[C@H](C3=CC=CC=C3)N)C |
Computed by PubChem (NCBI)