CAS 247940-08-5 is the registry number for 2-Methyl-4'-tert-butylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-tert-butyl-4-(2-methylphenyl)benzene (CAS 247940-08-5) is a chemical compound with the molecular formula C17H20 and a molecular weight of 224.34 g/mol. IUPAC name: 1-tert-butyl-4-(2-methylphenyl)benzene. InChIKey: RWAGEVSYASTPFD-UHFFFAOYSA-N.
| Molecular formula | C17H20 |
|---|---|
| Molecular weight | 224.34 g/mol |
| IUPAC name | 1-tert-butyl-4-(2-methylphenyl)benzene |
| InChIKey | RWAGEVSYASTPFD-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)