Products 247940-08-5

CAS 247940-08-5 is the registry number for 2-Methyl-4'-tert-butylbiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-tert-butyl-4-(2-methylphenyl)benzene (CAS 247940-08-5) is a chemical compound with the molecular formula C17H20 and a molecular weight of 224.34 g/mol. IUPAC name: 1-tert-butyl-4-(2-methylphenyl)benzene. InChIKey: RWAGEVSYASTPFD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20
Molecular weight224.34 g/mol
IUPAC name1-tert-butyl-4-(2-methylphenyl)benzene
InChIKeyRWAGEVSYASTPFD-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C2=CC=C(C=C2)C(C)(C)C

Computed by PubChem (NCBI)