CAS 2479465-67-1 appears in our catalog under these names: EBOV/MARV–IN–1, EBOV/MARV-IN-1 99%, EBOV/MARV-IN-1, 99.14%, VUN65671/ 98.67% (existing batch purity), N-(4-(4-Methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl)-4-(morpholinomethyl)benzamide. Offered by: GLPBio, Ambeed, MedChemExpress, TargetMol, Biosynth. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 5 mg.
N-[4-(4-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide (CAS 2479465-67-1) is a chemical compound with the molecular formula C25H30F3N3O2 and a molecular weight of 461.5 g/mol. IUPAC name: N-[4-(4-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide. InChIKey: VVJSZYWIEBDKTC-UHFFFAOYSA-N.
| Molecular formula | C25H30F3N3O2 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | N-[4-(4-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide |
| InChIKey | VVJSZYWIEBDKTC-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)NC(=O)C3=CC=C(C=C3)CN4CCOCC4)C(F)(F)F |
Computed by PubChem (NCBI)