CAS 2480122-80-1 is the registry number for Difenacoum Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2-bromo-3-iodophenyl)methoxy]-5-chloro-2-hydroxybenzaldehyde (CAS 2480122-80-1) is a chemical compound with the molecular formula C14H9BrClIO3 and a molecular weight of 467.48 g/mol. IUPAC name: 4-[(2-bromo-3-iodophenyl)methoxy]-5-chloro-2-hydroxybenzaldehyde. InChIKey: IDPDCMUAENNHDH-UHFFFAOYSA-N.
| Molecular formula | C14H9BrClIO3 |
|---|---|
| Molecular weight | 467.48 g/mol |
| IUPAC name | 4-[(2-bromo-3-iodophenyl)methoxy]-5-chloro-2-hydroxybenzaldehyde |
| InChIKey | IDPDCMUAENNHDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)Br)COC2=C(C=C(C(=C2)O)C=O)Cl |
Computed by PubChem (NCBI)