Products 2480283-93-8
CAS 2480283-93-8 is the registry number for hCAI/II-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-cyclopentyl-2-[(4-sulfamoylbenzoyl)amino]-1,3-thiazole-4-carboxamide (CAS 2480283-93-8) is a chemical compound with the molecular formula C16H18N4O4S2 and a molecular weight of 394.5 g/mol. IUPAC name: N-cyclopentyl-2-[(4-sulfamoylbenzoyl)amino]-1,3-thiazole-4-carboxamide. InChIKey: JEHIKSXSXUAHBT-UHFFFAOYSA-N.
| Molecular formula | C16H18N4O4S2 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | N-cyclopentyl-2-[(4-sulfamoylbenzoyl)amino]-1,3-thiazole-4-carboxamide |
| InChIKey | JEHIKSXSXUAHBT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)C2=CSC(=N2)NC(=O)C3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
hCAI/II-IN-3, orb1688205