CAS 24807-56-5 appears in our catalog under these names: 5-Bromo-3-nitro-1h-1,2,4-triazole, 95%, 3-Bromo-5-nitro-4h-1,2,4-triazole, 95%, 5-Bromo-3-nitro-1H-1,2,4-triazole, 97%, 97%, 5-bromo-3-nitro-1H-1,2,4-triazole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
3-bromo-5-nitro-1H-1,2,4-triazole (CAS 24807-56-5) is a chemical compound with the molecular formula C2HBrN4O2 and a molecular weight of 192.96 g/mol. IUPAC name: 3-bromo-5-nitro-1H-1,2,4-triazole. InChIKey: XXAMCWVPBITOGA-UHFFFAOYSA-N.
| Molecular formula | C2HBrN4O2 |
|---|---|
| Molecular weight | 192.96 g/mol |
| IUPAC name | 3-bromo-5-nitro-1H-1,2,4-triazole |
| InChIKey | XXAMCWVPBITOGA-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NN1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)