Products 2482467-23-0
CAS 2482467-23-0 is the registry number for α-Hydroxyglutaric acid-13C5 (disodium), 99.80%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-hydroxy(1,2,3,4,5-13C5)pentanedioic acid (CAS 2482467-23-0) is a chemical compound with the molecular formula C5H8O5 and a molecular weight of 153.08 g/mol. IUPAC name: 2-hydroxy(1,2,3,4,5-13C5)pentanedioic acid. InChIKey: HWXBTNAVRSUOJR-CVMUNTFWSA-N.
| Molecular formula | C5H8O5 |
|---|---|
| Molecular weight | 153.08 g/mol |
| IUPAC name | 2-hydroxy(1,2,3,4,5-13C5)pentanedioic acid |
| InChIKey | HWXBTNAVRSUOJR-CVMUNTFWSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13CH]([13C](=O)O)O |
Computed by PubChem (NCBI)