CAS 248282-07-7 appears in our catalog under these names: Laquinimod Sodium Salt, Laquinimod sodium, Laquinimod (sodium). Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 250mg, 25mg, 50mg, 100mg, Get quote.
Sodium 5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-olate (CAS 248282-07-7) is a chemical compound with the molecular formula C19H16ClN2NaO3 and a molecular weight of 378.8 g/mol. IUPAC name: sodium 5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-olate. InChIKey: JWHPPWBIIQMBQC-UHFFFAOYSA-M.
| Molecular formula | C19H16ClN2NaO3 |
|---|---|
| Molecular weight | 378.8 g/mol |
| IUPAC name | sodium 5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-olate |
| InChIKey | JWHPPWBIIQMBQC-UHFFFAOYSA-M |
| SMILES | CCN(C1=CC=CC=C1)C(=O)C2=C(C3=C(C=CC=C3Cl)N(C2=O)C)[O-].[Na+] |
Computed by PubChem (NCBI)