CAS 2483735-54-0 is the registry number for 1,2,3,4,5-Pentachlorobenzene-13C6, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
1,2,3,4,5-pentachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 2483735-54-0) is a chemical compound with the molecular formula C6HCl5 and a molecular weight of 256.3 g/mol. IUPAC name: 1,2,3,4,5-pentachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: CEOCDNVZRAIOQZ-IDEBNGHGSA-N.
| Molecular formula | C6HCl5 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1,2,3,4,5-pentachloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | CEOCDNVZRAIOQZ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13C]([13C](=[13C]1Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)