CAS 2483735-72-2 appears in our catalog under these names: (R)–3–Hydroxybutanoic acid–13C4 sodium, (R)-3-Hydroxybutanoic acid-13C4 (sodium), 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 1 mg, 5 mg, 100 mg, 25 mg.
CAS 2483735-72-2 identifies a chemical compound with the molecular formula C4H8NaO3 and a molecular weight of 131.065 g/mol. InChIKey: CWQQGENZHRKCMJ-UDJWXCBTSA-N.
| Molecular formula | C4H8NaO3 |
|---|---|
| Molecular weight | 131.065 g/mol |
| InChIKey | CWQQGENZHRKCMJ-UDJWXCBTSA-N |
| SMILES | [13CH3][13C@H]([13CH2][13C](=O)O)O.[Na] |
Computed by PubChem (NCBI)