CAS 2483735-82-4 is the registry number for Fonofos-¹³C₆. Offered by: TRC. Available pack sizes: 25mg.
(1,2,3,4,5,6-13C6)cyclohexatrienylsulfanyl-ethoxy-ethyl-sulfanylidene-lambda5-phosphane (CAS 2483735-82-4) is a chemical compound with the molecular formula C10H15OPS2 and a molecular weight of 252.3 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienylsulfanyl-ethoxy-ethyl-sulfanylidene-lambda5-phosphane. InChIKey: KVGLBTYUCJYMND-CYRQOIGNSA-N.
| Molecular formula | C10H15OPS2 |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienylsulfanyl-ethoxy-ethyl-sulfanylidene-lambda5-phosphane |
| InChIKey | KVGLBTYUCJYMND-CYRQOIGNSA-N |
| SMILES | CCOP(=S)(CC)S[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 |
Computed by PubChem (NCBI)