CAS 2483736-17-8 appears in our catalog under these names: Palmitic acid–13C16 sodium, Palmitic acid-13C16 (sodium), 98%, 98%, Palmitic acid-13C16 (sodium), 99.1%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 5 mg, 10 mg.
Sodium (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoate (CAS 2483736-17-8) is a chemical compound with the molecular formula C16H31NaO2 and a molecular weight of 294.29 g/mol. IUPAC name: sodium (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoate. InChIKey: GGXKEBACDBNFAF-SJIUKAAASA-M.
| Molecular formula | C16H31NaO2 |
|---|---|
| Molecular weight | 294.29 g/mol |
| IUPAC name | sodium (1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadecanoate |
| InChIKey | GGXKEBACDBNFAF-SJIUKAAASA-M |
| SMILES | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)