Products 2483829-94-1
CAS 2483829-94-1 appears in our catalog under these names: N-Octanoylglycine-13C2,15N, >95% (HPLC), 2-Octanamidoacetic acid-13C2,15N. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg, 5 mg.
2-(octanoyl(15N)amino)acetic acid (CAS 2483829-94-1) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 204.24 g/mol. IUPAC name: 2-(octanoyl(15N)amino)acetic acid. InChIKey: SAVLIIGUQOSOEP-HLDOMDIUSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 2-(octanoyl(15N)amino)acetic acid |
| InChIKey | SAVLIIGUQOSOEP-HLDOMDIUSA-N |
| SMILES | CCCCCCCC(=O)[15NH][13CH2][13C](=O)O |
Computed by PubChem (NCBI)