CAS 2483830-42-6 appears in our catalog under these names: Taurine–13C2,15N, Taurine-13C2,15N, 98.60%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
2-(15N)azanyl(1,2-13C2)ethanesulfonic acid (CAS 2483830-42-6) is a chemical compound with the molecular formula C2H7NO3S and a molecular weight of 128.13 g/mol. IUPAC name: 2-(15N)azanyl(1,2-13C2)ethanesulfonic acid. InChIKey: XOAAWQZATWQOTB-VMIGTVKRSA-N.
| Molecular formula | C2H7NO3S |
|---|---|
| Molecular weight | 128.13 g/mol |
| IUPAC name | 2-(15N)azanyl(1,2-13C2)ethanesulfonic acid |
| InChIKey | XOAAWQZATWQOTB-VMIGTVKRSA-N |
| SMILES | [13CH2]([13CH2]S(=O)(=O)O)[15NH2] |
Computed by PubChem (NCBI)