Products 2483831-48-5
CAS 2483831-48-5 appears in our catalog under these names: Diethyl phosphate-d10 (diethyl-d10), >95% (HPLC), Diethyl-d10 Phosphate, 99 atom % D, min 98% Chemical Purity, Diethyl phosphate–d10–1, Diethyl phosphate-d10-1, 99.70%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 0,01g, 1mg, 5 mg, 1 mg.
Bis(1,1,2,2,2-pentadeuterioethyl) hydrogen phosphate (CAS 2483831-48-5) is a chemical compound with the molecular formula C4H11O4P and a molecular weight of 164.16 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethyl) hydrogen phosphate. InChIKey: UCQFCFPECQILOL-MWUKXHIBSA-N.
| Molecular formula | C4H11O4P |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethyl) hydrogen phosphate |
| InChIKey | UCQFCFPECQILOL-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=O)(O)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)