CAS 2483831-84-9 appears in our catalog under these names: Choline O-sulfate - D13 ,98%, Choline-d13 (sulfate), 98.0%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, 500mg, 250mg, 50 mg, 100 mg, 250 mg.
[1,1,2,2-tetradeuterio-2-[tris(trideuteriomethyl)azaniumyl]ethyl] sulfate (CAS 2483831-84-9) is a chemical compound with the molecular formula C5H13NO4S and a molecular weight of 196.31 g/mol. IUPAC name: [1,1,2,2-tetradeuterio-2-[tris(trideuteriomethyl)azaniumyl]ethyl] sulfate. InChIKey: WXCQAWGXWVRCGP-RWNMDAAESA-N.
| Molecular formula | C5H13NO4S |
|---|---|
| Molecular weight | 196.31 g/mol |
| IUPAC name | [1,1,2,2-tetradeuterio-2-[tris(trideuteriomethyl)azaniumyl]ethyl] sulfate |
| InChIKey | WXCQAWGXWVRCGP-RWNMDAAESA-N |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)