Products 2483832-01-3
CAS 2483832-01-3 appears in our catalog under these names: DL-2-Amino-1,6-hexanedioic-2,5,5-d3 Acid, >95% (HPLC), DL-2-Amino-1,6-hexanedioic-2,5,5-d3 Acid, 98 atom % D, min 98% Chemical Purity, Aminoadipic acid–d3, Aminoadipic acid-d3, 99.12%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 50mg, 0,1g, 0,05g, 10mg, 5mg, 10 mg, 5 mg.
2-amino-2,5,5-trideuteriohexanedioic acid (CAS 2483832-01-3) is a chemical compound with the molecular formula C6H11NO4 and a molecular weight of 164.17 g/mol. IUPAC name: 2-amino-2,5,5-trideuteriohexanedioic acid. InChIKey: OYIFNHCXNCRBQI-FBYXXYQPSA-N.
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 164.17 g/mol |
| IUPAC name | 2-amino-2,5,5-trideuteriohexanedioic acid |
| InChIKey | OYIFNHCXNCRBQI-FBYXXYQPSA-N |
| SMILES | [2H]C([2H])(CCC([2H])(C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)