CAS 2484171-06-2 is the registry number for cis-Nonachlor-13C10. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2S,3R,5S,6R,7S)-1,3,4,5,7,8,9,10,10-nonachlorotricyclo[5.2.1.02,6]dec-8-ene (CAS 2484171-06-2) is a chemical compound with the molecular formula C10H5Cl9 and a molecular weight of 454.1 g/mol. IUPAC name: (1S,2S,3R,5S,6R,7S)-1,3,4,5,7,8,9,10,10-nonachlorotricyclo[5.2.1.02,6]dec-8-ene. InChIKey: OCHOKXCPKDPNQU-KQINIRROSA-N.
| Molecular formula | C10H5Cl9 |
|---|---|
| Molecular weight | 454.1 g/mol |
| IUPAC name | (1S,2S,3R,5S,6R,7S)-1,3,4,5,7,8,9,10,10-nonachlorotricyclo[5.2.1.02,6]dec-8-ene |
| InChIKey | OCHOKXCPKDPNQU-KQINIRROSA-N |
| SMILES | [13C@@H]12[13C@@H]([13C@H]([13CH]([13C@H]1Cl)Cl)Cl)[13C@@]3([13C](=[13C]([13C@@]2([13C]3(Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)