CAS 2484741-48-0 is the registry number for 4-(Bromomethyl)-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2484741-48-0) is a chemical compound with the molecular formula C14H11BrN2O4 and a molecular weight of 351.15 g/mol. IUPAC name: 4-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: BMUFZDMWULHGHY-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O4 |
|---|---|
| Molecular weight | 351.15 g/mol |
| IUPAC name | 4-(bromomethyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | BMUFZDMWULHGHY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC(=C3C2=O)CBr |
Computed by PubChem (NCBI)