CAS 24848-78-0 appears in our catalog under these names: Dibromopyromellitic Dianhydride, Dibromopyromellitic Dianhydride, >98.0%(HPLC), 4,8-Dibromobenzo[1,2-c:4,5-c']difuran-1,3,5,7-tetraone 98%, 4,8-Dibromobenzo[1,2-c:4,5-c']difuran-1,3,5,7-tetraone, 98%, 98%, 4,8-Dibromobenzo[1,2-c:4,5-c']difuran-1,3,5,7-tetraone, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g, 10g, 100mg, 250mg.
4,8-dibromofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone (CAS 24848-78-0) is a chemical compound with the molecular formula C10Br2O6 and a molecular weight of 375.91 g/mol. IUPAC name: 4,8-dibromofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone. InChIKey: OYIHYCLAXDDYFC-UHFFFAOYSA-N.
| Molecular formula | C10Br2O6 |
|---|---|
| Molecular weight | 375.91 g/mol |
| IUPAC name | 4,8-dibromofuro[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| InChIKey | OYIHYCLAXDDYFC-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C3C(=C1Br)C(=O)OC3=O)Br)C(=O)OC2=O |
Computed by PubChem (NCBI)