CAS 2484872-48-0 is the registry number for Aldol®, 470 phosphate, disodium salt, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.
Disodium;[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] phosphate (CAS 2484872-48-0) is a chemical compound with the molecular formula C23H18NNa2O7P and a molecular weight of 497.3 g/mol. IUPAC name: disodium;[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] phosphate. InChIKey: IDDQRIWFVLSCDS-UHFFFAOYSA-L.
| Molecular formula | C23H18NNa2O7P |
|---|---|
| Molecular weight | 497.3 g/mol |
| IUPAC name | disodium;[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] phosphate |
| InChIKey | IDDQRIWFVLSCDS-UHFFFAOYSA-L |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2N3C=C(C4=CC=CC=C43)OP(=O)([O-])[O-])OC.[Na+].[Na+] |
Computed by PubChem (NCBI)