Products 2484872-52-6

CAS 2484872-52-6 is the registry number for Aldol&reg, 458 nonanoate, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

[1-(2-acetylphenyl)indol-3-yl] nonanoate (CAS 2484872-52-6) is a chemical compound with the molecular formula C25H29NO3 and a molecular weight of 391.5 g/mol. IUPAC name: [1-(2-acetylphenyl)indol-3-yl] nonanoate. InChIKey: WQCGNMQXDBKEKL-UHFFFAOYSA-N.

Identity
Molecular formulaC25H29NO3
Molecular weight391.5 g/mol
IUPAC name[1-(2-acetylphenyl)indol-3-yl] nonanoate
InChIKeyWQCGNMQXDBKEKL-UHFFFAOYSA-N
SMILESCCCCCCCCC(=O)OC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C

Computed by PubChem (NCBI)