CAS 2484872-54-8 is the registry number for Aldol®, 458 phosphate, disodium salt, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g.
Disodium;[1-(2-methoxycarbonylphenyl)indol-3-yl] phosphate (CAS 2484872-54-8) is a chemical compound with the molecular formula C16H12NNa2O6P and a molecular weight of 391.22 g/mol. IUPAC name: disodium;[1-(2-methoxycarbonylphenyl)indol-3-yl] phosphate. InChIKey: DMPUHXGOFUPXJO-UHFFFAOYSA-L.
| Molecular formula | C16H12NNa2O6P |
|---|---|
| Molecular weight | 391.22 g/mol |
| IUPAC name | disodium;[1-(2-methoxycarbonylphenyl)indol-3-yl] phosphate |
| InChIKey | DMPUHXGOFUPXJO-UHFFFAOYSA-L |
| SMILES | COC(=O)C1=CC=CC=C1N2C=C(C3=CC=CC=C32)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)