CAS 2484872-83-3 is the registry number for Aldol®, 470 L-pyroglutamic acid amide, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.
(2S)-N-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]-5-oxopyrrolidine-2-carboxamide (CAS 2484872-83-3) is a chemical compound with the molecular formula C28H25N3O5 and a molecular weight of 483.5 g/mol. IUPAC name: (2S)-N-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]-5-oxopyrrolidine-2-carboxamide. InChIKey: JCNIICZRSCVJBB-NRFANRHFSA-N.
| Molecular formula | C28H25N3O5 |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | (2S)-N-[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl]-5-oxopyrrolidine-2-carboxamide |
| InChIKey | JCNIICZRSCVJBB-NRFANRHFSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2N3C=C(C4=CC=CC=C43)NC(=O)[C@@H]5CCC(=O)N5)OC |
Computed by PubChem (NCBI)