Products 2484872-95-7

CAS 2484872-95-7 is the registry number for Aldol&reg, 515 4-acetoxybutyrate solution, 0.75 M in DMSO, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

[1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] 4-acetyloxybutanoate (CAS 2484872-95-7) is a chemical compound with the molecular formula C29H28N2O5 and a molecular weight of 484.5 g/mol. IUPAC name: [1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] 4-acetyloxybutanoate. InChIKey: TUWFYOVDZRIGJT-UHFFFAOYSA-N.

Identity
Molecular formulaC29H28N2O5
Molecular weight484.5 g/mol
IUPAC name[1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] 4-acetyloxybutanoate
InChIKeyTUWFYOVDZRIGJT-UHFFFAOYSA-N
SMILESCC(=O)OCCCC(=O)OC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C4=CC=C(C=C4)N(C)C

Computed by PubChem (NCBI)