Products 2484873-04-1

CAS 2484873-04-1 is the registry number for Aldol&reg, 515 caprylate solution, 0.50 M in DMSO, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

[1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] octanoate (CAS 2484873-04-1) is a chemical compound with the molecular formula C31H34N2O3 and a molecular weight of 482.6 g/mol. IUPAC name: [1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] octanoate. InChIKey: OBXXTSKVWHVYSG-UHFFFAOYSA-N.

Identity
Molecular formulaC31H34N2O3
Molecular weight482.6 g/mol
IUPAC name[1-[2-[4-(dimethylamino)benzoyl]phenyl]indol-3-yl] octanoate
InChIKeyOBXXTSKVWHVYSG-UHFFFAOYSA-N
SMILESCCCCCCCC(=O)OC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C4=CC=C(C=C4)N(C)C

Computed by PubChem (NCBI)