Products 2621933-37-5
CAS 2621933-37-5 is the registry number for tert-butyl 1-formyl-3-trityl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1-formyl-3-trityl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 2621933-37-5) is a chemical compound with the molecular formula C31H34N2O3 and a molecular weight of 482.6 g/mol. IUPAC name: tert-butyl 1-formyl-3-trityl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: HSSFHRHNPYMYBR-UHFFFAOYSA-N.
| Molecular formula | C31H34N2O3 |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | tert-butyl 1-formyl-3-trityl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | HSSFHRHNPYMYBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(CN(C2)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C=O |
Computed by PubChem (NCBI)