CAS 2484873-25-6 is the registry number for STAADIUMâ„¢ PhosphoZide. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 2,5g.
Potassium;sodium;[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]phenyl] phosphate (CAS 2484873-25-6) is a chemical compound with the molecular formula C12H10KNNaO5PS and a molecular weight of 373.34 g/mol. IUPAC name: potassium;sodium;[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]phenyl] phosphate. InChIKey: BXQOPDMWBSCPHF-UHFFFAOYSA-L.
| Molecular formula | C12H10KNNaO5PS |
|---|---|
| Molecular weight | 373.34 g/mol |
| IUPAC name | potassium;sodium;[4-[(1-oxidopyridin-1-ium-2-yl)sulfanylmethyl]phenyl] phosphate |
| InChIKey | BXQOPDMWBSCPHF-UHFFFAOYSA-L |
| SMILES | C1=CC=[N+](C(=C1)SCC2=CC=C(C=C2)OP(=O)([O-])[O-])[O-].[Na+].[K+] |
Computed by PubChem (NCBI)