CAS 2484888-76-6 is the registry number for 4-Fluoro-3-iodo-6-(methylthio)-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
4-fluoro-3-iodo-6-methylsulfanyl-2H-indazole (CAS 2484888-76-6) is a chemical compound with the molecular formula C8H6FIN2S and a molecular weight of 308.12 g/mol. IUPAC name: 4-fluoro-3-iodo-6-methylsulfanyl-2H-indazole. InChIKey: PUJKNCRTKHBNFS-UHFFFAOYSA-N.
| Molecular formula | C8H6FIN2S |
|---|---|
| Molecular weight | 308.12 g/mol |
| IUPAC name | 4-fluoro-3-iodo-6-methylsulfanyl-2H-indazole |
| InChIKey | PUJKNCRTKHBNFS-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=NNC(=C2C(=C1)F)I |
Computed by PubChem (NCBI)