CAS 2484888-91-5 appears in our catalog under these names: 1-(1-(4-Chlorophenyl)ethyl)-2,4-difluorobenzene, 95%, 1-(1-(4-Chlorophenyl)ethyl)-2,4-difluorobenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-[1-(4-chlorophenyl)ethyl]-2,4-difluorobenzene (CAS 2484888-91-5) is a chemical compound with the molecular formula C14H11ClF2 and a molecular weight of 252.68 g/mol. IUPAC name: 1-[1-(4-chlorophenyl)ethyl]-2,4-difluorobenzene. InChIKey: LOUYZXGNSKPZCY-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF2 |
|---|---|
| Molecular weight | 252.68 g/mol |
| IUPAC name | 1-[1-(4-chlorophenyl)ethyl]-2,4-difluorobenzene |
| InChIKey | LOUYZXGNSKPZCY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Cl)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)