Products 2484905-94-2
CAS 2484905-94-2 is the registry number for 1-(4-methylpiperazin-1-yl)cyclopropanecarboxylic acid,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(4-methylpiperazin-1-yl)cyclopropane-1-carboxylic acid;dihydrochloride (CAS 2484905-94-2) is a chemical compound with the molecular formula C9H18Cl2N2O2 and a molecular weight of 257.15 g/mol. IUPAC name: 1-(4-methylpiperazin-1-yl)cyclopropane-1-carboxylic acid;dihydrochloride. InChIKey: PJWJSGAKAWCFQP-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2O2 |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 1-(4-methylpiperazin-1-yl)cyclopropane-1-carboxylic acid;dihydrochloride |
| InChIKey | PJWJSGAKAWCFQP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2(CC2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)