Products 2484976-99-8
CAS 2484976-99-8 is the registry number for AKB48–d9 (exempt preparation). Offered by: GLPBio. Available pack sizes: 1mg.
N-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indazole-3-carboxamide (CAS 2484976-99-8) is a chemical compound with the molecular formula C23H31N3O and a molecular weight of 374.6 g/mol. IUPAC name: N-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indazole-3-carboxamide. InChIKey: UCTCCIPCJZKWEZ-YGYNLGCDSA-N.
| Molecular formula | C23H31N3O |
|---|---|
| Molecular weight | 374.6 g/mol |
| IUPAC name | N-(1-adamantyl)-1-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)indazole-3-carboxamide |
| InChIKey | UCTCCIPCJZKWEZ-YGYNLGCDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CN1C2=CC=CC=C2C(=N1)C(=O)NC34CC5CC(C3)CC(C5)C4 |
Computed by PubChem (NCBI)