Products 3009018-61-2

CAS 3009018-61-2 is the registry number for σ1 Receptor/μ Opioid receptor modulator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

N-[2-(4-phenylpiperidin-1-yl)butyl]-N-pyridin-2-ylpropanamide (CAS 3009018-61-2) is a chemical compound with the molecular formula C23H31N3O and a molecular weight of 365.5 g/mol. IUPAC name: N-[2-(4-phenylpiperidin-1-yl)butyl]-N-pyridin-2-ylpropanamide. InChIKey: PGTIFUTZJAGUST-UHFFFAOYSA-N.

Identity
Molecular formulaC23H31N3O
Molecular weight365.5 g/mol
IUPAC nameN-[2-(4-phenylpiperidin-1-yl)butyl]-N-pyridin-2-ylpropanamide
InChIKeyPGTIFUTZJAGUST-UHFFFAOYSA-N
SMILESCCC(CN(C1=CC=CC=N1)C(=O)CC)N2CCC(CC2)C3=CC=CC=C3

Computed by PubChem (NCBI)