Products 2485732-75-8
CAS 2485732-75-8 is the registry number for 1-(4-Bromo-3-chlorophenyl)pyridin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-3-chlorophenyl)pyridin-2-one (CAS 2485732-75-8) is a chemical compound with the molecular formula C11H7BrClNO and a molecular weight of 284.53 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)pyridin-2-one. InChIKey: PIMFFGTUFKPUIB-UHFFFAOYSA-N.
| Molecular formula | C11H7BrClNO |
|---|---|
| Molecular weight | 284.53 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)pyridin-2-one |
| InChIKey | PIMFFGTUFKPUIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)