CAS 24867-26-3 appears in our catalog under these names: Minoxidil EP Impurity E, 2,4-Diamino-6-piperidinopyrimidine (Desoxyminoxidil), >95% (HPLC), 6-(Piperidin-1-yl)pyrimidine-2,4-diamine (Desoxyminoxidil), 2,4–Diamino–6–piperidinopyrimidine, 2,4-Diamino-6-piperidinopyrimidine (Standard). Offered by: Chemat Brand, TRC, Mikromol, GLPBio, MedChemExpress. Available pack sizes: on request, 100mg, 250mg, 500mg, 25mg, 1g, 5g, 25 mg.
6-piperidin-1-ylpyrimidine-2,4-diamine (CAS 24867-26-3) is a chemical compound with the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. IUPAC name: 6-piperidin-1-ylpyrimidine-2,4-diamine. InChIKey: IPFIEHIRBSTAKA-UHFFFAOYSA-N.
| Molecular formula | C9H15N5 |
|---|---|
| Molecular weight | 193.25 g/mol |
| IUPAC name | 6-piperidin-1-ylpyrimidine-2,4-diamine |
| InChIKey | IPFIEHIRBSTAKA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC(=NC(=C2)N)N |
Computed by PubChem (NCBI)