CAS 24886-73-5 appears in our catalog under these names: 1-Azidoadamantane, 1-AZIDOADAMANTANE, 97%, 1-Azidoadamantane, ≥97%, ≥97%. Offered by: TRC, Sigma-Aldrich, Chemat. Available pack sizes: 5mg, 1G, 5G, 100mg, 250mg.
1-azidoadamantane (CAS 24886-73-5) is a chemical compound with the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. IUPAC name: 1-azidoadamantane. InChIKey: JOMZSYXWYOVFEE-UHFFFAOYSA-N.
| Molecular formula | C10H15N3 |
|---|---|
| Molecular weight | 177.25 g/mol |
| IUPAC name | 1-azidoadamantane |
| InChIKey | JOMZSYXWYOVFEE-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)N=[N+]=[N-] |
Computed by PubChem (NCBI)