Products 2488794-62-1
CAS 2488794-62-1 is the registry number for (R)-1-(5-(Difluoromethyl)-4-fluorothiophen-3-yl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[5-(difluoromethyl)-4-fluorothiophen-3-yl]ethanamine (CAS 2488794-62-1) is a chemical compound with the molecular formula C7H8F3NS and a molecular weight of 195.21 g/mol. IUPAC name: (1R)-1-[5-(difluoromethyl)-4-fluorothiophen-3-yl]ethanamine. InChIKey: ODFZXDCBCQTCFB-GSVOUGTGSA-N.
| Molecular formula | C7H8F3NS |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (1R)-1-[5-(difluoromethyl)-4-fluorothiophen-3-yl]ethanamine |
| InChIKey | ODFZXDCBCQTCFB-GSVOUGTGSA-N |
| SMILES | C[C@H](C1=CSC(=C1F)C(F)F)N |
Computed by PubChem (NCBI)