CAS 2488858-07-5 is the registry number for Emedastine-d3. Offered by: TRC. Available pack sizes: 10mg.
1-(2-ethoxyethyl)-2-[4-(trideuteriomethyl)-1,4-diazepan-1-yl]benzimidazole (CAS 2488858-07-5) is a chemical compound with the molecular formula C17H26N4O and a molecular weight of 305.4 g/mol. IUPAC name: 1-(2-ethoxyethyl)-2-[4-(trideuteriomethyl)-1,4-diazepan-1-yl]benzimidazole. InChIKey: KBUZBQVCBVDWKX-BMSJAHLVSA-N.
| Molecular formula | C17H26N4O |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 1-(2-ethoxyethyl)-2-[4-(trideuteriomethyl)-1,4-diazepan-1-yl]benzimidazole |
| InChIKey | KBUZBQVCBVDWKX-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCN(CC1)C2=NC3=CC=CC=C3N2CCOCC |
Computed by PubChem (NCBI)